C20H21Cl2FN4O3 — CID 76618468
6-amino-7-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-N-[2-(dimethylamino)ethyl]furo[3,2-c]pyridine-3-carboxamide (PubChem CID 76618468) has the molecular formula C20H21Cl2FN4O3 and a molecular weight of 455.32 g/mol. Its IUPAC name is 6-amino-7-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-N-[2-(dimethylamino)ethyl]furo[3,2-c]pyridine-3-carboxamide.
| Compound Name | 6-amino-7-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-N-[2-(dimethylamino)ethyl]furo[3,2-c]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 76618468 |
| Molecular Formula | C20H21Cl2FN4O3 |
| Molecular Weight | 455.32 g/mol |
| Exact Mass | 454.10 |
| IUPAC Name | 6-amino-7-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-N-[2-(dimethylamino)ethyl]furo[3,2-c]pyridine-3-carboxamide |
| SMILES | CC(Oc1c(N)ncc2c(C(=O)NCCN(C)C)coc12)c1c(Cl)ccc(F)c1Cl |
| InChI | InChI=1S/C20H21Cl2FN4O3/c1-10(15-13(21)4-5-14(23)16(15)22)30-18-17-11(8-26-19(18)24)12(9-29-17)20(28)25-6-7-27(2)3/h4-5,8-10H,6-7H2,1-3H3,(H2,24,26)(H,25,28) |
| InChIKey | YSJWVIKLNFWDLV-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 93.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.32 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|