C26H25Cl2FN4O6S — CID 87387000
1-[2-[6-amino-7-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]furo[3,2-c]pyridin-3-yl]-4-carbamoylphenyl]-2-(dimethylamino)ethanesulfonic acid (PubChem CID 87387000) has the molecular formula C26H25Cl2FN4O6S and a molecular weight of 611.48 g/mol. Its IUPAC name is 1-[2-[6-amino-7-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]furo[3,2-c]pyridin-3-yl]-4-carbamoylphenyl]-2-(dimethylamino)ethanesulfonic acid.
| Compound Name | 1-[2-[6-amino-7-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]furo[3,2-c]pyridin-3-yl]-4-carbamoylphenyl]-2-(dimethylamino)ethanesulfonic acid |
|---|---|
| PubChem CID | 87387000 |
| Molecular Formula | C26H25Cl2FN4O6S |
| Molecular Weight | 611.48 g/mol |
| Exact Mass | 610.09 |
| IUPAC Name | 1-[2-[6-amino-7-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]furo[3,2-c]pyridin-3-yl]-4-carbamoylphenyl]-2-(dimethylamino)ethanesulfonic acid |
| SMILES | C[C@@H](Oc1c(N)ncc2c(-c3cc(C(N)=O)ccc3C(CN(C)C)S(=O)(=O)O)coc12)c1c(Cl)ccc(F)c1Cl |
| InChI | InChI=1S/C26H25Cl2FN4O6S/c1-12(21-18(27)6-7-19(29)22(21)28)39-24-23-16(9-32-25(24)30)17(11-38-23)15-8-13(26(31)34)4-5-14(15)20(10-33(2)3)40(35,36)37/h4-9,11-12,20H,10H2,1-3H3,(H2,30,32)(H2,31,34)(H,35,36,37)/t12-,20?/m1/s1 |
| InChIKey | XRLOXRHYWYCVOF-ZRIYNBNISA-N |
| XLogP | 5.25 |
| TPSA | 161.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.48 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|