C20H13Cl2FN2O3S — CID 88904847
5-[6-amino-7-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]furo[3,2-c]pyridin-3-yl]thiophene-3-carbaldehyde (PubChem CID 88904847) has the molecular formula C20H13Cl2FN2O3S and a molecular weight of 451.31 g/mol. Its IUPAC name is 5-[6-amino-7-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]furo[3,2-c]pyridin-3-yl]thiophene-3-carbaldehyde.
| Compound Name | 5-[6-amino-7-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]furo[3,2-c]pyridin-3-yl]thiophene-3-carbaldehyde |
|---|---|
| PubChem CID | 88904847 |
| Molecular Formula | C20H13Cl2FN2O3S |
| Molecular Weight | 451.31 g/mol |
| Exact Mass | 450.00 |
| IUPAC Name | 5-[6-amino-7-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]furo[3,2-c]pyridin-3-yl]thiophene-3-carbaldehyde |
| SMILES | C[C@@H](Oc1c(N)ncc2c(-c3cc(C=O)cs3)coc12)c1c(Cl)ccc(F)c1Cl |
| InChI | InChI=1S/C20H13Cl2FN2O3S/c1-9(16-13(21)2-3-14(23)17(16)22)28-19-18-11(5-25-20(19)24)12(7-27-18)15-4-10(6-26)8-29-15/h2-9H,1H3,(H2,24,25)/t9-/m1/s1 |
| InChIKey | NIRVNBPAKPUJFS-SECBINFHSA-N |
| XLogP | 6.54 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.31 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|