C26H24Cl2F2N4O2 — CID 90910268
7-[1-(2,6-dichloro-3,5-difluorophenyl)ethoxy]-3-[4-(4-methylpiperazin-1-yl)phenyl]furo[3,2-c]pyridin-6-amine (PubChem CID 90910268) has the molecular formula C26H24Cl2F2N4O2 and a molecular weight of 533.41 g/mol. Its IUPAC name is 7-[1-(2,6-dichloro-3,5-difluorophenyl)ethoxy]-3-[4-(4-methylpiperazin-1-yl)phenyl]furo[3,2-c]pyridin-6-amine.
| Compound Name | 7-[1-(2,6-dichloro-3,5-difluorophenyl)ethoxy]-3-[4-(4-methylpiperazin-1-yl)phenyl]furo[3,2-c]pyridin-6-amine |
|---|---|
| PubChem CID | 90910268 |
| Molecular Formula | C26H24Cl2F2N4O2 |
| Molecular Weight | 533.41 g/mol |
| Exact Mass | 532.12 |
| IUPAC Name | 7-[1-(2,6-dichloro-3,5-difluorophenyl)ethoxy]-3-[4-(4-methylpiperazin-1-yl)phenyl]furo[3,2-c]pyridin-6-amine |
| SMILES | CC(Oc1c(N)ncc2c(-c3ccc(N4CCN(C)CC4)cc3)coc12)c1c(Cl)c(F)cc(F)c1Cl |
| InChI | InChI=1S/C26H24Cl2F2N4O2/c1-14(21-22(27)19(29)11-20(30)23(21)28)36-25-24-17(12-32-26(25)31)18(13-35-24)15-3-5-16(6-4-15)34-9-7-33(2)8-10-34/h3-6,11-14H,7-10H2,1-2H3,(H2,31,32) |
| InChIKey | AXBYUYZWNJVGPN-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.41 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|