C20H13Cl2FN2O4S — CID 68633477
5-[6-amino-7-[2-(2,6-dichloro-3-fluorophenyl)ethoxy]furo[3,2-c]pyridin-3-yl]thiophene-3-carboxylic acid (PubChem CID 68633477) has the molecular formula C20H13Cl2FN2O4S and a molecular weight of 467.31 g/mol. Its IUPAC name is 5-[6-amino-7-[2-(2,6-dichloro-3-fluorophenyl)ethoxy]furo[3,2-c]pyridin-3-yl]thiophene-3-carboxylic acid.
| Compound Name | 5-[6-amino-7-[2-(2,6-dichloro-3-fluorophenyl)ethoxy]furo[3,2-c]pyridin-3-yl]thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 68633477 |
| Molecular Formula | C20H13Cl2FN2O4S |
| Molecular Weight | 467.31 g/mol |
| Exact Mass | 466.00 |
| IUPAC Name | 5-[6-amino-7-[2-(2,6-dichloro-3-fluorophenyl)ethoxy]furo[3,2-c]pyridin-3-yl]thiophene-3-carboxylic acid |
| SMILES | Nc1ncc2c(-c3cc(C(=O)O)cs3)coc2c1OCCc1c(Cl)ccc(F)c1Cl |
| InChI | InChI=1S/C20H13Cl2FN2O4S/c21-13-1-2-14(23)16(22)10(13)3-4-28-18-17-11(6-25-19(18)24)12(7-29-17)15-5-9(8-30-15)20(26)27/h1-2,5-8H,3-4H2,(H2,24,25)(H,26,27) |
| InChIKey | KCODBKYEKMLHJL-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 98.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.31 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|