C22H18Cl2FN3O2 — CID 90942213
3-[3-(aminomethyl)phenyl]-7-[2-(2,6-dichloro-3-fluorophenyl)ethoxy]furo[3,2-c]pyridin-6-amine (PubChem CID 90942213) has the molecular formula C22H18Cl2FN3O2 and a molecular weight of 446.31 g/mol. Its IUPAC name is 3-[3-(aminomethyl)phenyl]-7-[2-(2,6-dichloro-3-fluorophenyl)ethoxy]furo[3,2-c]pyridin-6-amine.
| Compound Name | 3-[3-(aminomethyl)phenyl]-7-[2-(2,6-dichloro-3-fluorophenyl)ethoxy]furo[3,2-c]pyridin-6-amine |
|---|---|
| PubChem CID | 90942213 |
| Molecular Formula | C22H18Cl2FN3O2 |
| Molecular Weight | 446.31 g/mol |
| Exact Mass | 445.08 |
| IUPAC Name | 3-[3-(aminomethyl)phenyl]-7-[2-(2,6-dichloro-3-fluorophenyl)ethoxy]furo[3,2-c]pyridin-6-amine |
| SMILES | NCc1cccc(-c2coc3c(OCCc4c(Cl)ccc(F)c4Cl)c(N)ncc23)c1 |
| InChI | InChI=1S/C22H18Cl2FN3O2/c23-17-4-5-18(25)19(24)14(17)6-7-29-21-20-15(10-28-22(21)27)16(11-30-20)13-3-1-2-12(8-13)9-26/h1-5,8,10-11H,6-7,9,26H2,(H2,27,28) |
| InChIKey | KZPDGJODVJXDAL-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.31 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|