C21H17Cl2FN4O3 — CID 143190257
N-[6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)prop-2-enoxy]-3-pyridinyl]-2-methoxypyridine-4-carboxamide (PubChem CID 143190257) has the molecular formula C21H17Cl2FN4O3 and a molecular weight of 463.30 g/mol. Its IUPAC name is N-[6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)prop-2-enoxy]-3-pyridinyl]-2-methoxypyridine-4-carboxamide.
| Compound Name | N-[6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)prop-2-enoxy]-3-pyridinyl]-2-methoxypyridine-4-carboxamide |
|---|---|
| PubChem CID | 143190257 |
| Molecular Formula | C21H17Cl2FN4O3 |
| Molecular Weight | 463.30 g/mol |
| Exact Mass | 462.07 |
| IUPAC Name | N-[6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)prop-2-enoxy]-3-pyridinyl]-2-methoxypyridine-4-carboxamide |
| SMILES | C=CC(Oc1cc(NC(=O)c2ccnc(OC)c2)cnc1N)c1c(Cl)ccc(F)c1Cl |
| InChI | InChI=1S/C21H17Cl2FN4O3/c1-3-15(18-13(22)4-5-14(24)19(18)23)31-16-9-12(10-27-20(16)25)28-21(29)11-6-7-26-17(8-11)30-2/h3-10,15H,1H2,2H3,(H2,25,27)(H,28,29) |
| InChIKey | HIQDFFFPBOWFHQ-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 99.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.30 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|