C27H29Cl2N3O3 — CID 142774241
2-[4-[6-amino-5-[(2,6-dichlorophenyl)methoxy]-3-pyridinyl]phenyl]-1-[4-(2-hydroxyethyl)piperidin-1-yl]ethanone (PubChem CID 142774241) has the molecular formula C27H29Cl2N3O3 and a molecular weight of 514.45 g/mol. Its IUPAC name is 2-[4-[6-amino-5-[(2,6-dichlorophenyl)methoxy]-3-pyridinyl]phenyl]-1-[4-(2-hydroxyethyl)piperidin-1-yl]ethanone.
| Compound Name | 2-[4-[6-amino-5-[(2,6-dichlorophenyl)methoxy]-3-pyridinyl]phenyl]-1-[4-(2-hydroxyethyl)piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 142774241 |
| Molecular Formula | C27H29Cl2N3O3 |
| Molecular Weight | 514.45 g/mol |
| Exact Mass | 513.16 |
| IUPAC Name | 2-[4-[6-amino-5-[(2,6-dichlorophenyl)methoxy]-3-pyridinyl]phenyl]-1-[4-(2-hydroxyethyl)piperidin-1-yl]ethanone |
| SMILES | Nc1ncc(-c2ccc(CC(=O)N3CCC(CCO)CC3)cc2)cc1OCc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C27H29Cl2N3O3/c28-23-2-1-3-24(29)22(23)17-35-25-15-21(16-31-27(25)30)20-6-4-19(5-7-20)14-26(34)32-11-8-18(9-12-32)10-13-33/h1-7,15-16,18,33H,8-14,17H2,(H2,30,31) |
| InChIKey | SUVVPIWKQMYTCU-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 88.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.45 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_OC_no_alk_C(3)', 'substructure': 'N/A'} |
|---|