C16H19NO4 — CID 121145492
2-ethoxy-N-[2-(furan-2-yl)-2-methoxyethyl]benzamide (PubChem CID 121145492) has the molecular formula C16H19NO4 and a molecular weight of 289.33 g/mol. Its IUPAC name is 2-ethoxy-N-[2-(furan-2-yl)-2-methoxyethyl]benzamide.
| Compound Name | 2-ethoxy-N-[2-(furan-2-yl)-2-methoxyethyl]benzamide |
|---|---|
| PubChem CID | 121145492 |
| Molecular Formula | C16H19NO4 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | 2-ethoxy-N-[2-(furan-2-yl)-2-methoxyethyl]benzamide |
| SMILES | CCOc1ccccc1C(=O)NCC(OC)c1ccco1 |
| InChI | InChI=1S/C16H19NO4/c1-3-20-13-8-5-4-7-12(13)16(18)17-11-15(19-2)14-9-6-10-21-14/h4-10,15H,3,11H2,1-2H3,(H,17,18) |
| InChIKey | QEQPLIIDCYIVEI-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 60.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |