C14H21NO4 — CID 71581289
N-(2,2-dimethoxyethyl)-2-propoxybenzamide (PubChem CID 71581289) has the molecular formula C14H21NO4 and a molecular weight of 267.32 g/mol. Its IUPAC name is N-(2,2-dimethoxyethyl)-2-propoxybenzamide.
| Compound Name | N-(2,2-dimethoxyethyl)-2-propoxybenzamide |
|---|---|
| PubChem CID | 71581289 |
| Molecular Formula | C14H21NO4 |
| Molecular Weight | 267.32 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | N-(2,2-dimethoxyethyl)-2-propoxybenzamide |
| SMILES | CCCOc1ccccc1C(=O)NCC(OC)OC |
| InChI | InChI=1S/C14H21NO4/c1-4-9-19-12-8-6-5-7-11(12)14(16)15-10-13(17-2)18-3/h5-8,13H,4,9-10H2,1-3H3,(H,15,16) |
| InChIKey | KEIKKSIPSNKAPQ-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.32 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|