C11H14N2O6 — CID 81414526
N-(1,3-dihydroxypropan-2-yl)-2-methoxy-6-nitrobenzamide (PubChem CID 81414526) has the molecular formula C11H14N2O6 and a molecular weight of 270.24 g/mol. Its IUPAC name is N-(1,3-dihydroxypropan-2-yl)-2-methoxy-6-nitrobenzamide.
| Compound Name | N-(1,3-dihydroxypropan-2-yl)-2-methoxy-6-nitrobenzamide |
|---|---|
| PubChem CID | 81414526 |
| Molecular Formula | C11H14N2O6 |
| Molecular Weight | 270.24 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | N-(1,3-dihydroxypropan-2-yl)-2-methoxy-6-nitrobenzamide |
| SMILES | COc1cccc([N+](=O)[O-])c1C(=O)NC(CO)CO |
| InChI | InChI=1S/C11H14N2O6/c1-19-9-4-2-3-8(13(17)18)10(9)11(16)12-7(5-14)6-15/h2-4,7,14-15H,5-6H2,1H3,(H,12,16) |
| InChIKey | WLVRRUVUZMAYBF-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 121.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.24 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|