C12H14N2O7 — CID 81395438
3-methoxy-2-[(2-methoxy-6-nitrobenzoyl)amino]propanoic acid (PubChem CID 81395438) has the molecular formula C12H14N2O7 and a molecular weight of 298.25 g/mol. Its IUPAC name is 3-methoxy-2-[(2-methoxy-6-nitrobenzoyl)amino]propanoic acid.
| Compound Name | 3-methoxy-2-[(2-methoxy-6-nitrobenzoyl)amino]propanoic acid |
|---|---|
| PubChem CID | 81395438 |
| Molecular Formula | C12H14N2O7 |
| Molecular Weight | 298.25 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | 3-methoxy-2-[(2-methoxy-6-nitrobenzoyl)amino]propanoic acid |
| SMILES | COCC(NC(=O)c1c(OC)cccc1[N+](=O)[O-])C(=O)O |
| InChI | InChI=1S/C12H14N2O7/c1-20-6-7(12(16)17)13-11(15)10-8(14(18)19)4-3-5-9(10)21-2/h3-5,7H,6H2,1-2H3,(H,13,15)(H,16,17) |
| InChIKey | HIMOASLANXULCE-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 128.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.25 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|