C14H20BrNO3 — CID 107729906
5-bromo-2-hydroxy-N-(2-hydroxy-2,4-dimethylpentyl)benzamide (PubChem CID 107729906) has the molecular formula C14H20BrNO3 and a molecular weight of 330.22 g/mol. Its IUPAC name is 5-bromo-2-hydroxy-N-(2-hydroxy-2,4-dimethylpentyl)benzamide.
| Compound Name | 5-bromo-2-hydroxy-N-(2-hydroxy-2,4-dimethylpentyl)benzamide |
|---|---|
| PubChem CID | 107729906 |
| Molecular Formula | C14H20BrNO3 |
| Molecular Weight | 330.22 g/mol |
| Exact Mass | 329.06 |
| IUPAC Name | 5-bromo-2-hydroxy-N-(2-hydroxy-2,4-dimethylpentyl)benzamide |
| SMILES | CC(C)CC(C)(O)CNC(=O)c1cc(Br)ccc1O |
| InChI | InChI=1S/C14H20BrNO3/c1-9(2)7-14(3,19)8-16-13(18)11-6-10(15)4-5-12(11)17/h4-6,9,17,19H,7-8H2,1-3H3,(H,16,18) |
| InChIKey | ZYMGOLKFYRYSCE-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.22 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |