C15H21BrClNO — CID 106144494
4-bromo-N-(5-chloro-2,2-dimethylpentyl)-2-methylbenzamide (PubChem CID 106144494) has the molecular formula C15H21BrClNO and a molecular weight of 346.70 g/mol. Its IUPAC name is 4-bromo-N-(5-chloro-2,2-dimethylpentyl)-2-methylbenzamide.
| Compound Name | 4-bromo-N-(5-chloro-2,2-dimethylpentyl)-2-methylbenzamide |
|---|---|
| PubChem CID | 106144494 |
| Molecular Formula | C15H21BrClNO |
| Molecular Weight | 346.70 g/mol |
| Exact Mass | 345.05 |
| IUPAC Name | 4-bromo-N-(5-chloro-2,2-dimethylpentyl)-2-methylbenzamide |
| SMILES | Cc1cc(Br)ccc1C(=O)NCC(C)(C)CCCCl |
| InChI | InChI=1S/C15H21BrClNO/c1-11-9-12(16)5-6-13(11)14(19)18-10-15(2,3)7-4-8-17/h5-6,9H,4,7-8,10H2,1-3H3,(H,18,19) |
| InChIKey | BGUBTVUZHZFSSR-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.70 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|