C13H19NO3 — CID 66168188
N-(2,3-dihydroxy-2-methylpropyl)-2,5-dimethylbenzamide (PubChem CID 66168188) has the molecular formula C13H19NO3 and a molecular weight of 237.30 g/mol. Its IUPAC name is N-(2,3-dihydroxy-2-methylpropyl)-2,5-dimethylbenzamide.
| Compound Name | N-(2,3-dihydroxy-2-methylpropyl)-2,5-dimethylbenzamide |
|---|---|
| PubChem CID | 66168188 |
| Molecular Formula | C13H19NO3 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.14 |
| IUPAC Name | N-(2,3-dihydroxy-2-methylpropyl)-2,5-dimethylbenzamide |
| SMILES | Cc1ccc(C)c(C(=O)NCC(C)(O)CO)c1 |
| InChI | InChI=1S/C13H19NO3/c1-9-4-5-10(2)11(6-9)12(16)14-7-13(3,17)8-15/h4-6,15,17H,7-8H2,1-3H3,(H,14,16) |
| InChIKey | PZPFBNCLJSYFJZ-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |