C23H31NO — CID 7112392
(2R)-N-(3,3-diphenylpropyl)-2-ethylhexanamide (PubChem CID 7112392) has the molecular formula C23H31NO and a molecular weight of 337.51 g/mol. Its IUPAC name is (2R)-N-(3,3-diphenylpropyl)-2-ethylhexanamide.
| Compound Name | (2R)-N-(3,3-diphenylpropyl)-2-ethylhexanamide |
|---|---|
| PubChem CID | 7112392 |
| Molecular Formula | C23H31NO |
| Molecular Weight | 337.51 g/mol |
| Exact Mass | 337.24 |
| IUPAC Name | (2R)-N-(3,3-diphenylpropyl)-2-ethylhexanamide |
| SMILES | CCCC[C@@H](CC)C(=O)NCCC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H31NO/c1-3-5-12-19(4-2)23(25)24-18-17-22(20-13-8-6-9-14-20)21-15-10-7-11-16-21/h6-11,13-16,19,22H,3-5,12,17-18H2,1-2H3,(H,24,25)/t19-/m1/s1 |
| InChIKey | YOBXNBWCORXMJJ-LJQANCHMSA-N |
| XLogP | 5.54 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.51 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |