C13H20N2O4S — CID 59031770
2-[2-(2-methylpropylamino)ethylcarbamoyl]benzenesulfonic acid (PubChem CID 59031770) has the molecular formula C13H20N2O4S and a molecular weight of 300.38 g/mol. Its IUPAC name is 2-[2-(2-methylpropylamino)ethylcarbamoyl]benzenesulfonic acid.
| Compound Name | 2-[2-(2-methylpropylamino)ethylcarbamoyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 59031770 |
| Molecular Formula | C13H20N2O4S |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | 2-[2-(2-methylpropylamino)ethylcarbamoyl]benzenesulfonic acid |
| SMILES | CC(C)CNCCNC(=O)c1ccccc1S(=O)(=O)O |
| InChI | InChI=1S/C13H20N2O4S/c1-10(2)9-14-7-8-15-13(16)11-5-3-4-6-12(11)20(17,18)19/h3-6,10,14H,7-9H2,1-2H3,(H,15,16)(H,17,18,19) |
| InChIKey | KSSBPYGZWUIOLA-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|