C11H10Br3NO6S — CID 18717058
3-hydroxy-2-[[2-(tribromomethylsulfonyl)benzoyl]amino]propanoic acid (PubChem CID 18717058) has the molecular formula C11H10Br3NO6S and a molecular weight of 523.98 g/mol. Its IUPAC name is 3-hydroxy-2-[[2-(tribromomethylsulfonyl)benzoyl]amino]propanoic acid.
| Compound Name | 3-hydroxy-2-[[2-(tribromomethylsulfonyl)benzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 18717058 |
| Molecular Formula | C11H10Br3NO6S |
| Molecular Weight | 523.98 g/mol |
| Exact Mass | 520.78 |
| IUPAC Name | 3-hydroxy-2-[[2-(tribromomethylsulfonyl)benzoyl]amino]propanoic acid |
| SMILES | O=C(NC(CO)C(=O)O)c1ccccc1S(=O)(=O)C(Br)(Br)Br |
| InChI | InChI=1S/C11H10Br3NO6S/c12-11(13,14)22(20,21)8-4-2-1-3-6(8)9(17)15-7(5-16)10(18)19/h1-4,7,16H,5H2,(H,15,17)(H,18,19) |
| InChIKey | PSDSZAPFWDEDBR-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 120.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.98 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|