C22H25Br6NO6S2 — CID 91538496
N-(6-hydroxyhexyl)-2-(tribromomethylsulfonyl)benzamide;1-methyl-2-(tribromomethylsulfonyl)benzene (PubChem CID 91538496) has the molecular formula C22H25Br6NO6S2 and a molecular weight of 943.00 g/mol. Its IUPAC name is N-(6-hydroxyhexyl)-2-(tribromomethylsulfonyl)benzamide;1-methyl-2-(tribromomethylsulfonyl)benzene.
| Compound Name | N-(6-hydroxyhexyl)-2-(tribromomethylsulfonyl)benzamide;1-methyl-2-(tribromomethylsulfonyl)benzene |
|---|---|
| PubChem CID | 91538496 |
| Molecular Formula | C22H25Br6NO6S2 |
| Molecular Weight | 943.00 g/mol |
| Exact Mass | 936.62 |
| IUPAC Name | N-(6-hydroxyhexyl)-2-(tribromomethylsulfonyl)benzamide;1-methyl-2-(tribromomethylsulfonyl)benzene |
| SMILES | Cc1ccccc1S(=O)(=O)C(Br)(Br)Br.O=C(NCCCCCCO)c1ccccc1S(=O)(=O)C(Br)(Br)Br |
| InChI | InChI=1S/C14H18Br3NO4S.C8H7Br3O2S/c15-14(16,17)23(21,22)12-8-4-3-7-11(12)13(20)18-9-5-1-2-6-10-19;1-6-4-2-3-5-7(6)14(12,13)8(9,10)11/h3-4,7-8,19H,1-2,5-6,9-10H2,(H,18,20);2-5H,1H3 |
| InChIKey | SUFWVDFSOKCLOU-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 117.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 943.00 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|