C13H11NO6S — CID 141047420
8-(methylsulfonyloxycarbamoyl)naphthalene-1-carboxylic acid (PubChem CID 141047420) has the molecular formula C13H11NO6S and a molecular weight of 309.30 g/mol. Its IUPAC name is 8-(methylsulfonyloxycarbamoyl)naphthalene-1-carboxylic acid.
| Compound Name | 8-(methylsulfonyloxycarbamoyl)naphthalene-1-carboxylic acid |
|---|---|
| PubChem CID | 141047420 |
| Molecular Formula | C13H11NO6S |
| Molecular Weight | 309.30 g/mol |
| Exact Mass | 309.03 |
| IUPAC Name | 8-(methylsulfonyloxycarbamoyl)naphthalene-1-carboxylic acid |
| SMILES | CS(=O)(=O)ONC(=O)c1cccc2cccc(C(=O)O)c12 |
| InChI | InChI=1S/C13H11NO6S/c1-21(18,19)20-14-12(15)9-6-2-4-8-5-3-7-10(11(8)9)13(16)17/h2-7H,1H3,(H,14,15)(H,16,17) |
| InChIKey | PXMUYLIBBACISQ-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.30 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|