C22H22N2O3 — CID 110612295
6-oxo-N-[3-(4-phenylmethoxyphenyl)propyl]-1H-pyridine-3-carboxamide (PubChem CID 110612295) has the molecular formula C22H22N2O3 and a molecular weight of 362.43 g/mol. Its IUPAC name is 6-oxo-N-[3-(4-phenylmethoxyphenyl)propyl]-1H-pyridine-3-carboxamide.
| Compound Name | 6-oxo-N-[3-(4-phenylmethoxyphenyl)propyl]-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 110612295 |
| Molecular Formula | C22H22N2O3 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | 6-oxo-N-[3-(4-phenylmethoxyphenyl)propyl]-1H-pyridine-3-carboxamide |
| SMILES | O=C(NCCCc1ccc(OCc2ccccc2)cc1)c1ccc(=O)[nH]c1 |
| InChI | InChI=1S/C22H22N2O3/c25-21-13-10-19(15-24-21)22(26)23-14-4-7-17-8-11-20(12-9-17)27-16-18-5-2-1-3-6-18/h1-3,5-6,8-13,15H,4,7,14,16H2,(H,23,26)(H,24,25) |
| InChIKey | ODSPIPZJDAVPLF-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|