C15H13Br2NO — CID 107980021
3,5-dibromo-N-(2-phenylethyl)benzamide (PubChem CID 107980021) has the molecular formula C15H13Br2NO and a molecular weight of 383.08 g/mol. Its IUPAC name is 3,5-dibromo-N-(2-phenylethyl)benzamide.
| Compound Name | 3,5-dibromo-N-(2-phenylethyl)benzamide |
|---|---|
| PubChem CID | 107980021 |
| Molecular Formula | C15H13Br2NO |
| Molecular Weight | 383.08 g/mol |
| Exact Mass | 380.94 |
| IUPAC Name | 3,5-dibromo-N-(2-phenylethyl)benzamide |
| SMILES | O=C(NCCc1ccccc1)c1cc(Br)cc(Br)c1 |
| InChI | InChI=1S/C15H13Br2NO/c16-13-8-12(9-14(17)10-13)15(19)18-7-6-11-4-2-1-3-5-11/h1-5,8-10H,6-7H2,(H,18,19) |
| InChIKey | GCEVYFTWYGRELZ-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.08 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |