C74H51F3O2S — CID 172859451
2,2,2-trifluoroacetate;tris(2,4,6-triphenylphenyl)sulfanium (PubChem CID 172859451) has the molecular formula C74H51F3O2S and a molecular weight of 1061.28 g/mol. Its IUPAC name is 2,2,2-trifluoroacetate;tris(2,4,6-triphenylphenyl)sulfanium.
| Compound Name | 2,2,2-trifluoroacetate;tris(2,4,6-triphenylphenyl)sulfanium |
|---|---|
| PubChem CID | 172859451 |
| Molecular Formula | C74H51F3O2S |
| Molecular Weight | 1061.28 g/mol |
| Exact Mass | 1060.36 |
| IUPAC Name | 2,2,2-trifluoroacetate;tris(2,4,6-triphenylphenyl)sulfanium |
| SMILES | O=C([O-])C(F)(F)F.c1ccc(-c2cc(-c3ccccc3)c([S+](c3c(-c4ccccc4)cc(-c4ccccc4)cc3-c3ccccc3)c3c(-c4ccccc4)cc(-c4ccccc4)cc3-c3ccccc3)c(-c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C72H51S.C2HF3O2/c1-10-28-52(29-11-1)61-46-64(55-34-16-4-17-35-55)70(65(47-61)56-36-18-5-19-37-56)73(71-66(57-38-20-6-21-39-57)48-62(53-30-12-2-13-31-53)49-67(71)58-40-22-7-23-41-58)72-68(59-42-24-8-25-43-59)50-63(54-32-14-3-15-33-54)51-69(72)60-44-26-9-27-45-60;3-2(4,5)1(6)7/h1-51H;(H,6,7)/q+1;/p-1 |
| InChIKey | ZDRPGLWGVTTZRE-UHFFFAOYSA-M |
| XLogP | 19.08 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 80 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1061.28 |
| LogP ≤ 5 | 19.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|