C65H54O2S — CID 157246543
adamantane-1-carboxylate;phenyl-bis(2,4,6-triphenylphenyl)sulfanium (PubChem CID 157246543) has the molecular formula C65H54O2S and a molecular weight of 899.21 g/mol. Its IUPAC name is adamantane-1-carboxylate;phenyl-bis(2,4,6-triphenylphenyl)sulfanium.
| Compound Name | adamantane-1-carboxylate;phenyl-bis(2,4,6-triphenylphenyl)sulfanium |
|---|---|
| PubChem CID | 157246543 |
| Molecular Formula | C65H54O2S |
| Molecular Weight | 899.21 g/mol |
| Exact Mass | 898.38 |
| IUPAC Name | adamantane-1-carboxylate;phenyl-bis(2,4,6-triphenylphenyl)sulfanium |
| SMILES | O=C([O-])C12CC3CC(CC(C3)C1)C2.c1ccc(-c2cc(-c3ccccc3)c([S+](c3ccccc3)c3c(-c4ccccc4)cc(-c4ccccc4)cc3-c3ccccc3)c(-c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C54H39S.C11H16O2/c1-8-22-40(23-9-1)46-36-49(42-26-12-3-13-27-42)53(50(37-46)43-28-14-4-15-29-43)55(48-34-20-7-21-35-48)54-51(44-30-16-5-17-31-44)38-47(41-24-10-2-11-25-41)39-52(54)45-32-18-6-19-33-45;12-10(13)11-4-7-1-8(5-11)3-9(2-7)6-11/h1-39H;7-9H,1-6H2,(H,12,13)/q+1;/p-1 |
| InChIKey | AVVKPDFKNCJLLY-UHFFFAOYSA-M |
| XLogP | 15.74 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 899.21 |
| LogP ≤ 5 | 15.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|