C20H15F3O11S — CID 172857600
2,2,2-trifluoroacetate;tris(2,4,6-trihydroxyphenyl)sulfanium (PubChem CID 172857600) has the molecular formula C20H15F3O11S and a molecular weight of 520.39 g/mol. Its IUPAC name is 2,2,2-trifluoroacetate;tris(2,4,6-trihydroxyphenyl)sulfanium.
| Compound Name | 2,2,2-trifluoroacetate;tris(2,4,6-trihydroxyphenyl)sulfanium |
|---|---|
| PubChem CID | 172857600 |
| Molecular Formula | C20H15F3O11S |
| Molecular Weight | 520.39 g/mol |
| Exact Mass | 520.03 |
| IUPAC Name | 2,2,2-trifluoroacetate;tris(2,4,6-trihydroxyphenyl)sulfanium |
| SMILES | O=C([O-])C(F)(F)F.Oc1cc(O)c([S+](c2c(O)cc(O)cc2O)c2c(O)cc(O)cc2O)c(O)c1 |
| InChI | InChI=1S/C18H14O9S.C2HF3O2/c19-7-1-10(22)16(11(23)2-7)28(17-12(24)3-8(20)4-13(17)25)18-14(26)5-9(21)6-15(18)27;3-2(4,5)1(6)7/h1-6H,(H8-,19,20,21,22,23,24,25,26,27);(H,6,7) |
| InChIKey | YXQQYMIRSYOARI-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 222.20 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.39 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|