About sodium;acetic acid;dodecanoate
sodium;acetic acid;dodecanoate (PubChem CID 162049902) has the molecular formula C14H27NaO4
and a molecular weight of 282.36 g/mol. Its IUPAC name is sodium;acetic acid;dodecanoate.
Molecular Properties
| Compound Name | sodium;acetic acid;dodecanoate |
| PubChem CID | 162049902 |
| Molecular Formula | C14H27NaO4 |
| Molecular Weight | 282.36 g/mol |
| Exact Mass | 282.18 |
| IUPAC Name | sodium;acetic acid;dodecanoate |
| SMILES | CC(=O)O.CCCCCCCCCCCC(=O)[O-].[Na+] |
| InChI | InChI=1S/C12H24O2.C2H4O2.Na/c1-2-3-4-5-6-7-8-9-10-11-12(13)14;1-2(3)4;/h2-11H2,1H3,(H,13,14);1H3,(H,3,4);/q;;+1/p-1 |
| InChIKey | YYKIMLRRJMFHAX-UHFFFAOYSA-M |
| XLogP | -0.25 |
| TPSA | 77.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.36 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze sodium;acetic acid;dodecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;acetic acid;dodecanoate?
The IUPAC name of sodium;acetic acid;dodecanoate (CID 162049902) is sodium;acetic acid;dodecanoate.
What is the SMILES notation for sodium;acetic acid;dodecanoate?
The canonical SMILES for sodium;acetic acid;dodecanoate is CC(=O)O.CCCCCCCCCCCC(=O)[O-].[Na+].
What is the InChIKey of sodium;acetic acid;dodecanoate?
The InChIKey is YYKIMLRRJMFHAX-UHFFFAOYSA-M. The full InChI is InChI=1S/C12H24O2.C2H4O2.Na/c1-2-3-4-5-6-7-8-9-10-11-12(13)14;1-2(3)4;/h2-11H2,1H3,(H,13,14);1H3,(H,3,4);/q;;+1/p-1.
What are the key properties of sodium;acetic acid;dodecanoate?
sodium;acetic acid;dodecanoate has a molecular weight of 282.36 g/mol, XLogP of -0.25, 10 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;acetic acid;dodecanoate is sourced from PubChem (CID 162049902), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).