About magnesium;acetic acid;octadecanoate;acetate
magnesium;acetic acid;octadecanoate;acetate (PubChem CID 175591716) has the molecular formula C24H46MgO8
and a molecular weight of 486.93 g/mol. Its IUPAC name is magnesium;acetic acid;octadecanoate;acetate.
Molecular Properties
| Compound Name | magnesium;acetic acid;octadecanoate;acetate |
| PubChem CID | 175591716 |
| Molecular Formula | C24H46MgO8 |
| Molecular Weight | 486.93 g/mol |
| Exact Mass | 486.30 |
| IUPAC Name | magnesium;acetic acid;octadecanoate;acetate |
| SMILES | CC(=O)O.CC(=O)O.CC(=O)[O-].CCCCCCCCCCCCCCCCCC(=O)[O-].[Mg+2] |
| InChI | InChI=1S/C18H36O2.3C2H4O2.Mg/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;3*1-2(3)4;/h2-17H2,1H3,(H,19,20);3*1H3,(H,3,4);/q;;;;+2/p-2 |
| InChIKey | ABTLGEGLQHWSQK-UHFFFAOYSA-L |
| XLogP | 3.56 |
| TPSA | 154.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 486.93 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze magnesium;acetic acid;octadecanoate;acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium;acetic acid;octadecanoate;acetate?
The IUPAC name of magnesium;acetic acid;octadecanoate;acetate (CID 175591716) is magnesium;acetic acid;octadecanoate;acetate.
What is the SMILES notation for magnesium;acetic acid;octadecanoate;acetate?
The canonical SMILES for magnesium;acetic acid;octadecanoate;acetate is CC(=O)O.CC(=O)O.CC(=O)[O-].CCCCCCCCCCCCCCCCCC(=O)[O-].[Mg+2].
What is the InChIKey of magnesium;acetic acid;octadecanoate;acetate?
The InChIKey is ABTLGEGLQHWSQK-UHFFFAOYSA-L. The full InChI is InChI=1S/C18H36O2.3C2H4O2.Mg/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;3*1-2(3)4;/h2-17H2,1H3,(H,19,20);3*1H3,(H,3,4);/q;;;;+2/p-2.
What are the key properties of magnesium;acetic acid;octadecanoate;acetate?
magnesium;acetic acid;octadecanoate;acetate has a molecular weight of 486.93 g/mol, XLogP of 3.56, 16 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium;acetic acid;octadecanoate;acetate is sourced from PubChem (CID 175591716), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).