C30H63NO10Si — CID 159089434
2-(dimethylamino)ethyl 2,2-dimethylbutanoate;2-hydroxyethyl 2,2-dimethylbutanoate;3-trimethoxysilylpropyl 2,2-dimethylbutanoate (PubChem CID 159089434) has the molecular formula C30H63NO10Si and a molecular weight of 625.92 g/mol. Its IUPAC name is 2-(dimethylamino)ethyl 2,2-dimethylbutanoate;2-hydroxyethyl 2,2-dimethylbutanoate;3-trimethoxysilylpropyl 2,2-dimethylbutanoate.
| Compound Name | 2-(dimethylamino)ethyl 2,2-dimethylbutanoate;2-hydroxyethyl 2,2-dimethylbutanoate;3-trimethoxysilylpropyl 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 159089434 |
| Molecular Formula | C30H63NO10Si |
| Molecular Weight | 625.92 g/mol |
| Exact Mass | 625.42 |
| IUPAC Name | 2-(dimethylamino)ethyl 2,2-dimethylbutanoate;2-hydroxyethyl 2,2-dimethylbutanoate;3-trimethoxysilylpropyl 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OCCC[Si](OC)(OC)OC.CCC(C)(C)C(=O)OCCN(C)C.CCC(C)(C)C(=O)OCCO |
| InChI | InChI=1S/C12H26O5Si.C10H21NO2.C8H16O3/c1-7-12(2,3)11(13)17-9-8-10-18(14-4,15-5)16-6;1-6-10(2,3)9(12)13-8-7-11(4)5;1-4-8(2,3)7(10)11-6-5-9/h7-10H2,1-6H3;6-8H2,1-5H3;9H,4-6H2,1-3H3 |
| InChIKey | KBWFDVXGTVSODF-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 130.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.92 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|