C13H16O6 — CID 70669312
(2-oxooxolan-3-yl) 3-(2-methylprop-2-enoyloxy)cyclobutane-1-carboxylate (PubChem CID 70669312) has the molecular formula C13H16O6 and a molecular weight of 268.26 g/mol. Its IUPAC name is (2-oxooxolan-3-yl) 3-(2-methylprop-2-enoyloxy)cyclobutane-1-carboxylate.
| Compound Name | (2-oxooxolan-3-yl) 3-(2-methylprop-2-enoyloxy)cyclobutane-1-carboxylate |
|---|---|
| PubChem CID | 70669312 |
| Molecular Formula | C13H16O6 |
| Molecular Weight | 268.26 g/mol |
| Exact Mass | 268.09 |
| IUPAC Name | (2-oxooxolan-3-yl) 3-(2-methylprop-2-enoyloxy)cyclobutane-1-carboxylate |
| SMILES | C=C(C)C(=O)OC1CC(C(=O)OC2CCOC2=O)C1 |
| InChI | InChI=1S/C13H16O6/c1-7(2)11(14)18-9-5-8(6-9)12(15)19-10-3-4-17-13(10)16/h8-10H,1,3-6H2,2H3 |
| InChIKey | TVDSVLGWOLVLMR-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.26 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|