C12H12INO6 — CID 163550920
[2-oxo-2-[(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl)oxy]ethyl] 2-imino-2-iodoacetate (PubChem CID 163550920) has the molecular formula C12H12INO6 and a molecular weight of 393.13 g/mol. Its IUPAC name is [2-oxo-2-[(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl)oxy]ethyl] 2-imino-2-iodoacetate.
| Compound Name | [2-oxo-2-[(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl)oxy]ethyl] 2-imino-2-iodoacetate |
|---|---|
| PubChem CID | 163550920 |
| Molecular Formula | C12H12INO6 |
| Molecular Weight | 393.13 g/mol |
| Exact Mass | 392.97 |
| IUPAC Name | [2-oxo-2-[(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl)oxy]ethyl] 2-imino-2-iodoacetate |
| SMILES | [H]/N=C(\I)C(=O)OCC(=O)OC1C2CC3C(=O)OC1C3C2 |
| InChI | InChI=1S/C12H12INO6/c13-10(14)12(17)18-3-7(15)19-8-4-1-5-6(2-4)11(16)20-9(5)8/h4-6,8-9,14H,1-3H2/b14-10- |
| InChIKey | FIZNIUYPMDCMMS-UVTDQMKNSA-N |
| XLogP | 0.44 |
| TPSA | 102.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.13 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|