C19H22F3O9S- — CID 140620807
1,1,1-trifluoro-3-[2-[(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl)oxycarbonyl]cyclohexanecarbonyl]oxypropane-2-sulfonate (PubChem CID 140620807) has the molecular formula C19H22F3O9S- and a molecular weight of 483.44 g/mol. Its IUPAC name is 1,1,1-trifluoro-3-[2-[(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl)oxycarbonyl]cyclohexanecarbonyl]oxypropane-2-sulfonate.
| Compound Name | 1,1,1-trifluoro-3-[2-[(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl)oxycarbonyl]cyclohexanecarbonyl]oxypropane-2-sulfonate |
|---|---|
| PubChem CID | 140620807 |
| Molecular Formula | C19H22F3O9S- |
| Molecular Weight | 483.44 g/mol |
| Exact Mass | 483.09 |
| IUPAC Name | 1,1,1-trifluoro-3-[2-[(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl)oxycarbonyl]cyclohexanecarbonyl]oxypropane-2-sulfonate |
| SMILES | O=C(OCC(C(F)(F)F)S(=O)(=O)[O-])C1CCCCC1C(=O)OC1C2CC3C(=O)OC1C3C2 |
| InChI | InChI=1S/C19H23F3O9S/c20-19(21,22)13(32(26,27)28)7-29-16(23)9-3-1-2-4-10(9)17(24)30-14-8-5-11-12(6-8)18(25)31-15(11)14/h8-15H,1-7H2,(H,26,27,28)/p-1 |
| InChIKey | XVNLJPQHWOSHOQ-UHFFFAOYSA-M |
| XLogP | 1.31 |
| TPSA | 136.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.44 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|