C20H26NNaO8S2 — CID 23579811
sodium 2-[4-[1-[2-[2-(2-methylprop-2-enoyloxy)ethylcarbamoyloxy]ethylsulfanyl]propan-2-yl]phenyl]sulfonylacetate (PubChem CID 23579811) has the molecular formula C20H26NNaO8S2 and a molecular weight of 495.55 g/mol. Its IUPAC name is sodium 2-[4-[1-[2-[2-(2-methylprop-2-enoyloxy)ethylcarbamoyloxy]ethylsulfanyl]propan-2-yl]phenyl]sulfonylacetate.
| Compound Name | sodium 2-[4-[1-[2-[2-(2-methylprop-2-enoyloxy)ethylcarbamoyloxy]ethylsulfanyl]propan-2-yl]phenyl]sulfonylacetate |
|---|---|
| PubChem CID | 23579811 |
| Molecular Formula | C20H26NNaO8S2 |
| Molecular Weight | 495.55 g/mol |
| Exact Mass | 495.10 |
| IUPAC Name | sodium 2-[4-[1-[2-[2-(2-methylprop-2-enoyloxy)ethylcarbamoyloxy]ethylsulfanyl]propan-2-yl]phenyl]sulfonylacetate |
| SMILES | C=C(C)C(=O)OCCNC(=O)OCCSCC(C)c1ccc(S(=O)(=O)CC(=O)[O-])cc1.[Na+] |
| InChI | InChI=1S/C20H27NO8S2.Na/c1-14(2)19(24)28-9-8-21-20(25)29-10-11-30-12-15(3)16-4-6-17(7-5-16)31(26,27)13-18(22)23;/h4-7,15H,1,8-13H2,2-3H3,(H,21,25)(H,22,23);/q;+1/p-1 |
| InChIKey | FSDXMARQVKUYGQ-UHFFFAOYSA-M |
| XLogP | -2.10 |
| TPSA | 138.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.55 |
| LogP ≤ 5 | -2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|