C14H24KNO8S — CID 58502697
potassium [3-(2-methylbutoxy)-2-(2-prop-2-enoyloxyethylcarbamoyloxy)propyl] sulfite (PubChem CID 58502697) has the molecular formula C14H24KNO8S and a molecular weight of 405.51 g/mol. Its IUPAC name is potassium [3-(2-methylbutoxy)-2-(2-prop-2-enoyloxyethylcarbamoyloxy)propyl] sulfite.
| Compound Name | potassium [3-(2-methylbutoxy)-2-(2-prop-2-enoyloxyethylcarbamoyloxy)propyl] sulfite |
|---|---|
| PubChem CID | 58502697 |
| Molecular Formula | C14H24KNO8S |
| Molecular Weight | 405.51 g/mol |
| Exact Mass | 405.09 |
| IUPAC Name | potassium [3-(2-methylbutoxy)-2-(2-prop-2-enoyloxyethylcarbamoyloxy)propyl] sulfite |
| SMILES | C=CC(=O)OCCNC(=O)OC(COCC(C)CC)COS(=O)[O-].[K+] |
| InChI | InChI=1S/C14H25NO8S.K/c1-4-11(3)8-20-9-12(10-22-24(18)19)23-14(17)15-6-7-21-13(16)5-2;/h5,11-12H,2,4,6-10H2,1,3H3,(H,15,17)(H,18,19);/q;+1/p-1 |
| InChIKey | KRYBOJPVEXBESG-UHFFFAOYSA-M |
| XLogP | -2.31 |
| TPSA | 123.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.51 |
| LogP ≤ 5 | -2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|