C14H25NO8S — CID 58502698
2-[[1-(2-methylbutoxy)-3-sulfinooxypropan-2-yl]oxycarbonylamino]ethyl prop-2-enoate (PubChem CID 58502698) has the molecular formula C14H25NO8S and a molecular weight of 367.42 g/mol. Its IUPAC name is 2-[[1-(2-methylbutoxy)-3-sulfinooxypropan-2-yl]oxycarbonylamino]ethyl prop-2-enoate.
| Compound Name | 2-[[1-(2-methylbutoxy)-3-sulfinooxypropan-2-yl]oxycarbonylamino]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 58502698 |
| Molecular Formula | C14H25NO8S |
| Molecular Weight | 367.42 g/mol |
| Exact Mass | 367.13 |
| IUPAC Name | 2-[[1-(2-methylbutoxy)-3-sulfinooxypropan-2-yl]oxycarbonylamino]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCNC(=O)OC(COCC(C)CC)COS(=O)O |
| InChI | InChI=1S/C14H25NO8S/c1-4-11(3)8-20-9-12(10-22-24(18)19)23-14(17)15-6-7-21-13(16)5-2/h5,11-12H,2,4,6-10H2,1,3H3,(H,15,17)(H,18,19) |
| InChIKey | UHPUZUKQMNZWOQ-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 120.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.42 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|