C14H25N3O5 — CID 144569647
2-[[2-(butylcarbamoyloxy)ethyl-methylcarbamoyl]amino]ethyl prop-2-enoate (PubChem CID 144569647) has the molecular formula C14H25N3O5 and a molecular weight of 315.37 g/mol. Its IUPAC name is 2-[[2-(butylcarbamoyloxy)ethyl-methylcarbamoyl]amino]ethyl prop-2-enoate.
| Compound Name | 2-[[2-(butylcarbamoyloxy)ethyl-methylcarbamoyl]amino]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 144569647 |
| Molecular Formula | C14H25N3O5 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.18 |
| IUPAC Name | 2-[[2-(butylcarbamoyloxy)ethyl-methylcarbamoyl]amino]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCNC(=O)N(C)CCOC(=O)NCCCC |
| InChI | InChI=1S/C14H25N3O5/c1-4-6-7-16-14(20)22-11-9-17(3)13(19)15-8-10-21-12(18)5-2/h5H,2,4,6-11H2,1,3H3,(H,15,19)(H,16,20) |
| InChIKey | MGPRFCXQUCSRMM-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|