C19H37N3O5 — CID 90146010
2-(butylcarbamoyloxy)ethyl prop-2-enoate;N-methylmethanamine;2-methyl-N-propylprop-2-enamide (PubChem CID 90146010) has the molecular formula C19H37N3O5 and a molecular weight of 387.52 g/mol. Its IUPAC name is 2-(butylcarbamoyloxy)ethyl prop-2-enoate;N-methylmethanamine;2-methyl-N-propylprop-2-enamide.
| Compound Name | 2-(butylcarbamoyloxy)ethyl prop-2-enoate;N-methylmethanamine;2-methyl-N-propylprop-2-enamide |
|---|---|
| PubChem CID | 90146010 |
| Molecular Formula | C19H37N3O5 |
| Molecular Weight | 387.52 g/mol |
| Exact Mass | 387.27 |
| IUPAC Name | 2-(butylcarbamoyloxy)ethyl prop-2-enoate;N-methylmethanamine;2-methyl-N-propylprop-2-enamide |
| SMILES | C=C(C)C(=O)NCCC.C=CC(=O)OCCOC(=O)NCCCC.CNC |
| InChI | InChI=1S/C10H17NO4.C7H13NO.C2H7N/c1-3-5-6-11-10(13)15-8-7-14-9(12)4-2;1-4-5-8-7(9)6(2)3;1-3-2/h4H,2-3,5-8H2,1H3,(H,11,13);2,4-5H2,1,3H3,(H,8,9);3H,1-2H3 |
| InChIKey | JZEMGRIHSZGTCM-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.52 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|