C27H42O11 — CID 90141070
3-[2-(3-oxobutoxymethyl)-3-(3-prop-2-enoyloxypropoxy)-2-(2-prop-2-enoyloxypropoxymethyl)propoxy]propyl prop-2-enoate (PubChem CID 90141070) has the molecular formula C27H42O11 and a molecular weight of 542.62 g/mol. Its IUPAC name is 3-[2-(3-oxobutoxymethyl)-3-(3-prop-2-enoyloxypropoxy)-2-(2-prop-2-enoyloxypropoxymethyl)propoxy]propyl prop-2-enoate.
| Compound Name | 3-[2-(3-oxobutoxymethyl)-3-(3-prop-2-enoyloxypropoxy)-2-(2-prop-2-enoyloxypropoxymethyl)propoxy]propyl prop-2-enoate |
|---|---|
| PubChem CID | 90141070 |
| Molecular Formula | C27H42O11 |
| Molecular Weight | 542.62 g/mol |
| Exact Mass | 542.27 |
| IUPAC Name | 3-[2-(3-oxobutoxymethyl)-3-(3-prop-2-enoyloxypropoxy)-2-(2-prop-2-enoyloxypropoxymethyl)propoxy]propyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCOCC(COCCCOC(=O)C=C)(COCCC(C)=O)COCC(C)OC(=O)C=C |
| InChI | InChI=1S/C27H42O11/c1-6-24(29)36-14-9-12-32-18-27(20-34-16-11-22(4)28,19-33-13-10-15-37-25(30)7-2)21-35-17-23(5)38-26(31)8-3/h6-8,23H,1-3,9-21H2,4-5H3 |
| InChIKey | MAEPOEZYTJOBIF-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 132.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.62 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|