C24H48O8 — CID 176816174
10,13-dihydroxy-9,12-bis(2-hydroxypropoxy)octadecanoic acid (PubChem CID 176816174) has the molecular formula C24H48O8 and a molecular weight of 464.64 g/mol. Its IUPAC name is 10,13-dihydroxy-9,12-bis(2-hydroxypropoxy)octadecanoic acid.
| Compound Name | 10,13-dihydroxy-9,12-bis(2-hydroxypropoxy)octadecanoic acid |
|---|---|
| PubChem CID | 176816174 |
| Molecular Formula | C24H48O8 |
| Molecular Weight | 464.64 g/mol |
| Exact Mass | 464.33 |
| IUPAC Name | 10,13-dihydroxy-9,12-bis(2-hydroxypropoxy)octadecanoic acid |
| SMILES | CCCCCC(O)C(CC(O)C(CCCCCCCC(=O)O)OCC(C)O)OCC(C)O |
| InChI | InChI=1S/C24H48O8/c1-4-5-9-12-20(27)23(32-17-19(3)26)15-21(28)22(31-16-18(2)25)13-10-7-6-8-11-14-24(29)30/h18-23,25-28H,4-17H2,1-3H3,(H,29,30) |
| InChIKey | ZPDYESVOGXEZLE-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 136.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.64 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|