C12H20N2O3 — CID 158101930
2-(2-hydroxypropoxy)propan-1-ol;bis(prop-2-enenitrile) (PubChem CID 158101930) has the molecular formula C12H20N2O3 and a molecular weight of 240.30 g/mol. Its IUPAC name is 2-(2-hydroxypropoxy)propan-1-ol;bis(prop-2-enenitrile).
| Compound Name | 2-(2-hydroxypropoxy)propan-1-ol;bis(prop-2-enenitrile) |
|---|---|
| PubChem CID | 158101930 |
| Molecular Formula | C12H20N2O3 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.15 |
| IUPAC Name | 2-(2-hydroxypropoxy)propan-1-ol;bis(prop-2-enenitrile) |
| SMILES | C=CC#N.C=CC#N.CC(O)COC(C)CO |
| InChI | InChI=1S/C6H14O3.2C3H3N/c1-5(8)4-9-6(2)3-7;2*1-2-3-4/h5-8H,3-4H2,1-2H3;2*2H,1H2 |
| InChIKey | FPJFGVOYRXZDKN-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 97.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|