C7H16F4O8S2 — CID 87127958
bis(1,2-difluoroethanesulfonic acid);propane-1,2-diol (PubChem CID 87127958) has the molecular formula C7H16F4O8S2 and a molecular weight of 368.32 g/mol. Its IUPAC name is bis(1,2-difluoroethanesulfonic acid);propane-1,2-diol.
| Compound Name | bis(1,2-difluoroethanesulfonic acid);propane-1,2-diol |
|---|---|
| PubChem CID | 87127958 |
| Molecular Formula | C7H16F4O8S2 |
| Molecular Weight | 368.32 g/mol |
| Exact Mass | 368.02 |
| IUPAC Name | bis(1,2-difluoroethanesulfonic acid);propane-1,2-diol |
| SMILES | CC(O)CO.O=S(=O)(O)C(F)CF.O=S(=O)(O)C(F)CF |
| InChI | InChI=1S/C3H8O2.2C2H4F2O3S/c1-3(5)2-4;2*3-1-2(4)8(5,6)7/h3-5H,2H2,1H3;2*2H,1H2,(H,5,6,7) |
| InChIKey | OLUXYBYJFZARBG-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.32 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|