C9H19BrO2 — CID 165442725
4-(bromomethyl)-1,2-dimethoxyhexane (PubChem CID 165442725) has the molecular formula C9H19BrO2 and a molecular weight of 239.15 g/mol. Its IUPAC name is 4-(bromomethyl)-1,2-dimethoxyhexane.
| Compound Name | 4-(bromomethyl)-1,2-dimethoxyhexane |
|---|---|
| PubChem CID | 165442725 |
| Molecular Formula | C9H19BrO2 |
| Molecular Weight | 239.15 g/mol |
| Exact Mass | 238.06 |
| IUPAC Name | 4-(bromomethyl)-1,2-dimethoxyhexane |
| SMILES | CCC(CBr)CC(COC)OC |
| InChI | InChI=1S/C9H19BrO2/c1-4-8(6-10)5-9(12-3)7-11-2/h8-9H,4-7H2,1-3H3 |
| InChIKey | SMUCTABGOXPECJ-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.15 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|