C9H19N3O6S — CID 106340266
(2S,3R)-3-hydroxy-2-[3-(methanesulfonamido)propylcarbamoylamino]butanoic acid (PubChem CID 106340266) has the molecular formula C9H19N3O6S and a molecular weight of 297.33 g/mol. Its IUPAC name is (2S,3R)-3-hydroxy-2-[3-(methanesulfonamido)propylcarbamoylamino]butanoic acid.
| Compound Name | (2S,3R)-3-hydroxy-2-[3-(methanesulfonamido)propylcarbamoylamino]butanoic acid |
|---|---|
| PubChem CID | 106340266 |
| Molecular Formula | C9H19N3O6S |
| Molecular Weight | 297.33 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | (2S,3R)-3-hydroxy-2-[3-(methanesulfonamido)propylcarbamoylamino]butanoic acid |
| SMILES | C[C@@H](O)[C@H](NC(=O)NCCCNS(C)(=O)=O)C(=O)O |
| InChI | InChI=1S/C9H19N3O6S/c1-6(13)7(8(14)15)12-9(16)10-4-3-5-11-19(2,17)18/h6-7,11,13H,3-5H2,1-2H3,(H,14,15)(H2,10,12,16)/t6-,7+/m1/s1 |
| InChIKey | IBCDLBROHYWNDA-RQJHMYQMSA-N |
| XLogP | -1.94 |
| TPSA | 144.83 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.33 |
| LogP ≤ 5 | -1.94 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|