C9H18N2O5 — CID 104965839
(2S,3R)-3-hydroxy-2-(3-methoxypropylcarbamoylamino)butanoic acid (PubChem CID 104965839) has the molecular formula C9H18N2O5 and a molecular weight of 234.25 g/mol. Its IUPAC name is (2S,3R)-3-hydroxy-2-(3-methoxypropylcarbamoylamino)butanoic acid.
| Compound Name | (2S,3R)-3-hydroxy-2-(3-methoxypropylcarbamoylamino)butanoic acid |
|---|---|
| PubChem CID | 104965839 |
| Molecular Formula | C9H18N2O5 |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.12 |
| IUPAC Name | (2S,3R)-3-hydroxy-2-(3-methoxypropylcarbamoylamino)butanoic acid |
| SMILES | COCCCNC(=O)N[C@H](C(=O)O)[C@@H](C)O |
| InChI | InChI=1S/C9H18N2O5/c1-6(12)7(8(13)14)11-9(15)10-4-3-5-16-2/h6-7,12H,3-5H2,1-2H3,(H,13,14)(H2,10,11,15)/t6-,7+/m1/s1 |
| InChIKey | ZFKISGHBGSWFGH-RQJHMYQMSA-N |
| XLogP | -0.84 |
| TPSA | 107.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|