2-[2-(methanesulfonamido)ethylcarbamoylamino]hexanoic acid

C10H21N3O5S — CID 61200748

IUPAC2-[2-(methanesulfonamido)ethylcarbamoylamino]hexanoic acid
SMILESCCCCC(NC(=O)NCCNS(C)(=O)=O)C(=O)O
InChIInChI=1S/C10H21N3O5S/c1-3-4-5-8(9(14)15)13-10(16)11-6-7-12-19(2,17)18/h8,12H,3-7H2,1-2H3,(H,14,15)(H2,11,13,16)
InChIKeyYGNNTQXJHFAOAH-UHFFFAOYSA-N
MW295.36 g/mol
LogP-0.52
Rot. Bonds9

About 2-[2-(methanesulfonamido)ethylcarbamoylamino]hexanoic acid

2-[2-(methanesulfonamido)ethylcarbamoylamino]hexanoic acid (PubChem CID 61200748) has the molecular formula C10H21N3O5S and a molecular weight of 295.36 g/mol. Its IUPAC name is 2-[2-(methanesulfonamido)ethylcarbamoylamino]hexanoic acid.

Molecular Properties

Compound Name2-[2-(methanesulfonamido)ethylcarbamoylamino]hexanoic acid
PubChem CID61200748
Molecular FormulaC10H21N3O5S
Molecular Weight295.36 g/mol
Exact Mass295.12
IUPAC Name2-[2-(methanesulfonamido)ethylcarbamoylamino]hexanoic acid
SMILESCCCCC(NC(=O)NCCNS(C)(=O)=O)C(=O)O
InChIInChI=1S/C10H21N3O5S/c1-3-4-5-8(9(14)15)13-10(16)11-6-7-12-19(2,17)18/h8,12H,3-7H2,1-2H3,(H,14,15)(H2,11,13,16)
InChIKeyYGNNTQXJHFAOAH-UHFFFAOYSA-N
XLogP-0.52
TPSA124.60 Ų
H-Bond Donors4
H-Bond Acceptors4
Rotatable Bonds9
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500295.36
LogP ≤ 5-0.52
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 2-[2-(methanesulfonamido)ethylcarbamoylamino]hexanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[2-(methanesulfonamido)ethylcarbamoylamino]hexanoic acid?
The IUPAC name of 2-[2-(methanesulfonamido)ethylcarbamoylamino]hexanoic acid (CID 61200748) is 2-[2-(methanesulfonamido)ethylcarbamoylamino]hexanoic acid.
What is the SMILES notation for 2-[2-(methanesulfonamido)ethylcarbamoylamino]hexanoic acid?
The canonical SMILES for 2-[2-(methanesulfonamido)ethylcarbamoylamino]hexanoic acid is CCCCC(NC(=O)NCCNS(C)(=O)=O)C(=O)O.
What is the InChIKey of 2-[2-(methanesulfonamido)ethylcarbamoylamino]hexanoic acid?
The InChIKey is YGNNTQXJHFAOAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21N3O5S/c1-3-4-5-8(9(14)15)13-10(16)11-6-7-12-19(2,17)18/h8,12H,3-7H2,1-2H3,(H,14,15)(H2,11,13,16).
What are the key properties of 2-[2-(methanesulfonamido)ethylcarbamoylamino]hexanoic acid?
2-[2-(methanesulfonamido)ethylcarbamoylamino]hexanoic acid has a molecular weight of 295.36 g/mol, XLogP of -0.52, 9 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(methanesulfonamido)ethylcarbamoylamino]hexanoic acid is sourced from PubChem (CID 61200748), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).