C10H21N3O5S — CID 61200748
2-[2-(methanesulfonamido)ethylcarbamoylamino]hexanoic acid (PubChem CID 61200748) has the molecular formula C10H21N3O5S and a molecular weight of 295.36 g/mol. Its IUPAC name is 2-[2-(methanesulfonamido)ethylcarbamoylamino]hexanoic acid.
| Compound Name | 2-[2-(methanesulfonamido)ethylcarbamoylamino]hexanoic acid |
|---|---|
| PubChem CID | 61200748 |
| Molecular Formula | C10H21N3O5S |
| Molecular Weight | 295.36 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | 2-[2-(methanesulfonamido)ethylcarbamoylamino]hexanoic acid |
| SMILES | CCCCC(NC(=O)NCCNS(C)(=O)=O)C(=O)O |
| InChI | InChI=1S/C10H21N3O5S/c1-3-4-5-8(9(14)15)13-10(16)11-6-7-12-19(2,17)18/h8,12H,3-7H2,1-2H3,(H,14,15)(H2,11,13,16) |
| InChIKey | YGNNTQXJHFAOAH-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 124.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.36 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|