C12H25N3O5S — CID 107146129
(2S)-2-[[2-(methanesulfonamido)-2-methylpropyl]carbamoylamino]hexanoic acid (PubChem CID 107146129) has the molecular formula C12H25N3O5S and a molecular weight of 323.42 g/mol. Its IUPAC name is (2S)-2-[[2-(methanesulfonamido)-2-methylpropyl]carbamoylamino]hexanoic acid.
| Compound Name | (2S)-2-[[2-(methanesulfonamido)-2-methylpropyl]carbamoylamino]hexanoic acid |
|---|---|
| PubChem CID | 107146129 |
| Molecular Formula | C12H25N3O5S |
| Molecular Weight | 323.42 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | (2S)-2-[[2-(methanesulfonamido)-2-methylpropyl]carbamoylamino]hexanoic acid |
| SMILES | CCCC[C@H](NC(=O)NCC(C)(C)NS(C)(=O)=O)C(=O)O |
| InChI | InChI=1S/C12H25N3O5S/c1-5-6-7-9(10(16)17)14-11(18)13-8-12(2,3)15-21(4,19)20/h9,15H,5-8H2,1-4H3,(H,16,17)(H2,13,14,18)/t9-/m0/s1 |
| InChIKey | LBRGQPFNJYARCR-VIFPVBQESA-N |
| XLogP | 0.26 |
| TPSA | 124.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.42 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |