C10H20N4O6S — CID 63859891
(2S)-4-amino-2-[[2-(methanesulfonamido)-2-methylpropyl]carbamoylamino]-4-oxobutanoic acid (PubChem CID 63859891) has the molecular formula C10H20N4O6S and a molecular weight of 324.36 g/mol. Its IUPAC name is (2S)-4-amino-2-[[2-(methanesulfonamido)-2-methylpropyl]carbamoylamino]-4-oxobutanoic acid.
| Compound Name | (2S)-4-amino-2-[[2-(methanesulfonamido)-2-methylpropyl]carbamoylamino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 63859891 |
| Molecular Formula | C10H20N4O6S |
| Molecular Weight | 324.36 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | (2S)-4-amino-2-[[2-(methanesulfonamido)-2-methylpropyl]carbamoylamino]-4-oxobutanoic acid |
| SMILES | CC(C)(CNC(=O)N[C@@H](CC(N)=O)C(=O)O)NS(C)(=O)=O |
| InChI | InChI=1S/C10H20N4O6S/c1-10(2,14-21(3,19)20)5-12-9(18)13-6(8(16)17)4-7(11)15/h6,14H,4-5H2,1-3H3,(H2,11,15)(H,16,17)(H2,12,13,18)/t6-/m0/s1 |
| InChIKey | ZLTBIIRPJIEBTF-LURJTMIESA-N |
| XLogP | -2.06 |
| TPSA | 167.69 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.36 |
| LogP ≤ 5 | -2.06 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |