C15H30N2O3 — CID 107567309
(2R)-2-(2,2-dimethylheptylcarbamoylamino)pentanoic acid (PubChem CID 107567309) has the molecular formula C15H30N2O3 and a molecular weight of 286.42 g/mol. Its IUPAC name is (2R)-2-(2,2-dimethylheptylcarbamoylamino)pentanoic acid.
| Compound Name | (2R)-2-(2,2-dimethylheptylcarbamoylamino)pentanoic acid |
|---|---|
| PubChem CID | 107567309 |
| Molecular Formula | C15H30N2O3 |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.23 |
| IUPAC Name | (2R)-2-(2,2-dimethylheptylcarbamoylamino)pentanoic acid |
| SMILES | CCCCCC(C)(C)CNC(=O)N[C@H](CCC)C(=O)O |
| InChI | InChI=1S/C15H30N2O3/c1-5-7-8-10-15(3,4)11-16-14(20)17-12(9-6-2)13(18)19/h12H,5-11H2,1-4H3,(H,18,19)(H2,16,17,20)/t12-/m1/s1 |
| InChIKey | YWYYNBRXMCNYBW-GFCCVEGCSA-N |
| XLogP | 3.15 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|