C13H16FNO5S — CID 43100976
2-[[2-(4-fluorophenyl)acetyl]amino]-4-methylsulfonylbutanoic acid (PubChem CID 43100976) has the molecular formula C13H16FNO5S and a molecular weight of 317.34 g/mol. Its IUPAC name is 2-[[2-(4-fluorophenyl)acetyl]amino]-4-methylsulfonylbutanoic acid.
| Compound Name | 2-[[2-(4-fluorophenyl)acetyl]amino]-4-methylsulfonylbutanoic acid |
|---|---|
| PubChem CID | 43100976 |
| Molecular Formula | C13H16FNO5S |
| Molecular Weight | 317.34 g/mol |
| Exact Mass | 317.07 |
| IUPAC Name | 2-[[2-(4-fluorophenyl)acetyl]amino]-4-methylsulfonylbutanoic acid |
| SMILES | CS(=O)(=O)CCC(NC(=O)Cc1ccc(F)cc1)C(=O)O |
| InChI | InChI=1S/C13H16FNO5S/c1-21(19,20)7-6-11(13(17)18)15-12(16)8-9-2-4-10(14)5-3-9/h2-5,11H,6-8H2,1H3,(H,15,16)(H,17,18) |
| InChIKey | OUUSCLDIDNLAQQ-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.34 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |