C12H15FN2O5S — CID 61028864
2-[(3-fluorophenyl)carbamoylamino]-4-methylsulfonylbutanoic acid (PubChem CID 61028864) has the molecular formula C12H15FN2O5S and a molecular weight of 318.33 g/mol. Its IUPAC name is 2-[(3-fluorophenyl)carbamoylamino]-4-methylsulfonylbutanoic acid.
| Compound Name | 2-[(3-fluorophenyl)carbamoylamino]-4-methylsulfonylbutanoic acid |
|---|---|
| PubChem CID | 61028864 |
| Molecular Formula | C12H15FN2O5S |
| Molecular Weight | 318.33 g/mol |
| Exact Mass | 318.07 |
| IUPAC Name | 2-[(3-fluorophenyl)carbamoylamino]-4-methylsulfonylbutanoic acid |
| SMILES | CS(=O)(=O)CCC(NC(=O)Nc1cccc(F)c1)C(=O)O |
| InChI | InChI=1S/C12H15FN2O5S/c1-21(19,20)6-5-10(11(16)17)15-12(18)14-9-4-2-3-8(13)7-9/h2-4,7,10H,5-6H2,1H3,(H,16,17)(H2,14,15,18) |
| InChIKey | ICFQGVPTCXPGGY-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.33 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |