C12H24N2O6S — CID 107201639
2-[[5-hydroxypentyl(methyl)carbamoyl]amino]-4-methylsulfonylbutanoic acid (PubChem CID 107201639) has the molecular formula C12H24N2O6S and a molecular weight of 324.40 g/mol. Its IUPAC name is 2-[[5-hydroxypentyl(methyl)carbamoyl]amino]-4-methylsulfonylbutanoic acid.
| Compound Name | 2-[[5-hydroxypentyl(methyl)carbamoyl]amino]-4-methylsulfonylbutanoic acid |
|---|---|
| PubChem CID | 107201639 |
| Molecular Formula | C12H24N2O6S |
| Molecular Weight | 324.40 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | 2-[[5-hydroxypentyl(methyl)carbamoyl]amino]-4-methylsulfonylbutanoic acid |
| SMILES | CN(CCCCCO)C(=O)NC(CCS(C)(=O)=O)C(=O)O |
| InChI | InChI=1S/C12H24N2O6S/c1-14(7-4-3-5-8-15)12(18)13-10(11(16)17)6-9-21(2,19)20/h10,15H,3-9H2,1-2H3,(H,13,18)(H,16,17) |
| InChIKey | DFXBKSJAFYZVBJ-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 124.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.40 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|